C33H23N3O2 — CID 102275823
1-(4-nitrophenyl)-5-phenyl-2-(4-phenylphenyl)-1,1a-dihydroazirino[1,2-a]quinoxaline (PubChem CID 102275823) has the molecular formula C33H23N3O2 and a molecular weight of 493.57 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-5-phenyl-2-(4-phenylphenyl)-1,1a-dihydroazirino[1,2-a]quinoxaline.
| Compound Name | 1-(4-nitrophenyl)-5-phenyl-2-(4-phenylphenyl)-1,1a-dihydroazirino[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 102275823 |
| Molecular Formula | C33H23N3O2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 1-(4-nitrophenyl)-5-phenyl-2-(4-phenylphenyl)-1,1a-dihydroazirino[1,2-a]quinoxaline |
| SMILES | O=[N+]([O-])c1ccc(C2C3C(c4ccc(-c5ccccc5)cc4)=Nc4cc(-c5ccccc5)ccc4N32)cc1 |
| InChI | InChI=1S/C33H23N3O2/c37-36(38)28-18-15-26(16-19-28)32-33-31(25-13-11-24(12-14-25)22-7-3-1-4-8-22)34-29-21-27(17-20-30(29)35(32)33)23-9-5-2-6-10-23/h1-21,32-33H |
| InChIKey | RYRRAQAUJMJDMK-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|