C28H29N3O2 — CID 19590346
5,6-dimethyl-1-(4-nitrophenyl)-2-(4-pentylphenyl)-1,1a-dihydroazirino[1,2-a]quinoxaline (PubChem CID 19590346) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 5,6-dimethyl-1-(4-nitrophenyl)-2-(4-pentylphenyl)-1,1a-dihydroazirino[1,2-a]quinoxaline.
| Compound Name | 5,6-dimethyl-1-(4-nitrophenyl)-2-(4-pentylphenyl)-1,1a-dihydroazirino[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 19590346 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 5,6-dimethyl-1-(4-nitrophenyl)-2-(4-pentylphenyl)-1,1a-dihydroazirino[1,2-a]quinoxaline |
| SMILES | CCCCCc1ccc(C2=Nc3cc(C)c(C)cc3N3C2C3c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C28H29N3O2/c1-4-5-6-7-20-8-10-21(11-9-20)26-28-27(22-12-14-23(15-13-22)31(32)33)30(28)25-17-19(3)18(2)16-24(25)29-26/h8-17,27-28H,4-7H2,1-3H3 |
| InChIKey | FDMHQIIJUYLFAI-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|