C23H18FN3O2 — CID 3602773
2-(4-fluorophenyl)-5,6-dimethyl-1-(4-nitrophenyl)-1,1a-dihydroazirino[1,2-a]quinoxaline (PubChem CID 3602773) has the molecular formula C23H18FN3O2 and a molecular weight of 387.41 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5,6-dimethyl-1-(4-nitrophenyl)-1,1a-dihydroazirino[1,2-a]quinoxaline.
| Compound Name | 2-(4-fluorophenyl)-5,6-dimethyl-1-(4-nitrophenyl)-1,1a-dihydroazirino[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 3602773 |
| Molecular Formula | C23H18FN3O2 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2-(4-fluorophenyl)-5,6-dimethyl-1-(4-nitrophenyl)-1,1a-dihydroazirino[1,2-a]quinoxaline |
| SMILES | Cc1cc2c(cc1C)N1C(C(c3ccc(F)cc3)=N2)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H18FN3O2/c1-13-11-19-20(12-14(13)2)26-22(16-5-9-18(10-6-16)27(28)29)23(26)21(25-19)15-3-7-17(24)8-4-15/h3-12,22-23H,1-2H3 |
| InChIKey | IDGDJCBNAVPLFE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|