C23H43NO4 — CID 162403767
tert-butyl (2S)-2-(4-hydroxy-2-oxotridecyl)piperidine-1-carboxylate (PubChem CID 162403767) has the molecular formula C23H43NO4 and a molecular weight of 397.60 g/mol. Its IUPAC name is tert-butyl (2S)-2-(4-hydroxy-2-oxotridecyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(4-hydroxy-2-oxotridecyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 162403767 |
| Molecular Formula | C23H43NO4 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.32 |
| IUPAC Name | tert-butyl (2S)-2-(4-hydroxy-2-oxotridecyl)piperidine-1-carboxylate |
| SMILES | CCCCCCCCCC(O)CC(=O)C[C@@H]1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H43NO4/c1-5-6-7-8-9-10-11-15-20(25)18-21(26)17-19-14-12-13-16-24(19)22(27)28-23(2,3)4/h19-20,25H,5-18H2,1-4H3/t19-,20?/m0/s1 |
| InChIKey | KDTFILDFUXUALR-XJDOXCRVSA-N |
| XLogP | 5.63 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|