C20H20N2O4 — CID 162403872
(4S,5R,7R)-9-benzyl-3,4-dimethyl-7-phenyl-1,6-dioxa-3,9-diazaspiro[4.4]nonane-2,8-dione (PubChem CID 162403872) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is (4S,5R,7R)-9-benzyl-3,4-dimethyl-7-phenyl-1,6-dioxa-3,9-diazaspiro[4.4]nonane-2,8-dione.
| Compound Name | (4S,5R,7R)-9-benzyl-3,4-dimethyl-7-phenyl-1,6-dioxa-3,9-diazaspiro[4.4]nonane-2,8-dione |
|---|---|
| PubChem CID | 162403872 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (4S,5R,7R)-9-benzyl-3,4-dimethyl-7-phenyl-1,6-dioxa-3,9-diazaspiro[4.4]nonane-2,8-dione |
| SMILES | C[C@@H]1N(C)C(=O)O[C@]12O[C@H](c1ccccc1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C20H20N2O4/c1-14-20(26-19(24)21(14)2)22(13-15-9-5-3-6-10-15)18(23)17(25-20)16-11-7-4-8-12-16/h3-12,14,17H,13H2,1-2H3/t14-,17+,20+/m0/s1 |
| InChIKey | AVVHXXGVMCXHBK-JNAXZKDPSA-N |
| XLogP | 2.91 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |