C39H27F9NO3PS — CID 162404983
[[2-[bis[3-(trifluoromethyl)phenyl]methyl]-4-pyridinyl]-triphenyl-λ5-phosphanyl] trifluoromethanesulfonate (PubChem CID 162404983) has the molecular formula C39H27F9NO3PS and a molecular weight of 791.67 g/mol. Its IUPAC name is [[2-[bis[3-(trifluoromethyl)phenyl]methyl]-4-pyridinyl]-triphenyl-λ5-phosphanyl] trifluoromethanesulfonate.
| Compound Name | [[2-[bis[3-(trifluoromethyl)phenyl]methyl]-4-pyridinyl]-triphenyl-λ5-phosphanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162404983 |
| Molecular Formula | C39H27F9NO3PS |
| Molecular Weight | 791.67 g/mol |
| Exact Mass | 791.13 |
| IUPAC Name | [[2-[bis[3-(trifluoromethyl)phenyl]methyl]-4-pyridinyl]-triphenyl-λ5-phosphanyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OP(c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccnc(C(c2cccc(C(F)(F)F)c2)c2cccc(C(F)(F)F)c2)c1)C(F)(F)F |
| InChI | InChI=1S/C39H27F9NO3PS/c40-37(41,42)29-14-10-12-27(24-29)36(28-13-11-15-30(25-28)38(43,44)45)35-26-34(22-23-49-35)53(31-16-4-1-5-17-31,32-18-6-2-7-19-32,33-20-8-3-9-21-33)52-54(50,51)39(46,47)48/h1-26,36H |
| InChIKey | RBJDVCNQAAKJFD-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.67 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|