C24H35NO6 — CID 162405020
tert-butyl N-[2-[(1R)-7-methoxy-8-(methoxymethoxy)-2-oxo-1-prop-2-enyl-3,4-dihydronaphthalen-1-yl]ethyl]-N-methylcarbamate (PubChem CID 162405020) has the molecular formula C24H35NO6 and a molecular weight of 433.55 g/mol. Its IUPAC name is tert-butyl N-[2-[(1R)-7-methoxy-8-(methoxymethoxy)-2-oxo-1-prop-2-enyl-3,4-dihydronaphthalen-1-yl]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[(1R)-7-methoxy-8-(methoxymethoxy)-2-oxo-1-prop-2-enyl-3,4-dihydronaphthalen-1-yl]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 162405020 |
| Molecular Formula | C24H35NO6 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | tert-butyl N-[2-[(1R)-7-methoxy-8-(methoxymethoxy)-2-oxo-1-prop-2-enyl-3,4-dihydronaphthalen-1-yl]ethyl]-N-methylcarbamate |
| SMILES | C=CC[C@]1(CCN(C)C(=O)OC(C)(C)C)C(=O)CCc2ccc(OC)c(OCOC)c21 |
| InChI | InChI=1S/C24H35NO6/c1-8-13-24(14-15-25(5)22(27)31-23(2,3)4)19(26)12-10-17-9-11-18(29-7)21(20(17)24)30-16-28-6/h8-9,11H,1,10,12-16H2,2-7H3/t24-/m0/s1 |
| InChIKey | WVYKEMWIYFYTPF-DEOSSOPVSA-N |
| XLogP | 4.26 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|