C12H13FO2 — CID 162406650
2-[(E)-2-(3-fluorophenyl)ethenyl]-1,4-dioxane (PubChem CID 162406650) has the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. Its IUPAC name is 2-[(E)-2-(3-fluorophenyl)ethenyl]-1,4-dioxane.
| Compound Name | 2-[(E)-2-(3-fluorophenyl)ethenyl]-1,4-dioxane |
|---|---|
| PubChem CID | 162406650 |
| Molecular Formula | C12H13FO2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 2-[(E)-2-(3-fluorophenyl)ethenyl]-1,4-dioxane |
| SMILES | Fc1cccc(/C=C/C2COCCO2)c1 |
| InChI | InChI=1S/C12H13FO2/c13-11-3-1-2-10(8-11)4-5-12-9-14-6-7-15-12/h1-5,8,12H,6-7,9H2/b5-4+ |
| InChIKey | HKOSMQWYHHPCOJ-SNAWJCMRSA-N |
| XLogP | 2.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |