About CID 162407125
CID 162407125 (PubChem CID 162407125) has the molecular formula C16H22BN3O2
and a molecular weight of 299.18 g/mol.
Molecular Properties
| Compound Name | CID 162407125 |
| PubChem CID | 162407125 |
| Molecular Formula | C16H22BN3O2 |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C([B-]c1n(C)cc[n+]1C)Cc1ccccc1N |
| InChI | InChI=1S/C16H22BN3O2/c1-4-22-15(21)13(11-12-7-5-6-8-14(12)18)17-16-19(2)9-10-20(16)3/h5-10,13H,4,11,18H2,1-3H3 |
| InChIKey | YRNXXHGSGYJKOX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 61.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 162407125 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162407125?
The IUPAC name of CID 162407125 (CID 162407125) is not available.
What is the SMILES notation for CID 162407125?
The canonical SMILES for CID 162407125 is CCOC(=O)C([B-]c1n(C)cc[n+]1C)Cc1ccccc1N.
What is the InChIKey of CID 162407125?
The InChIKey is YRNXXHGSGYJKOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22BN3O2/c1-4-22-15(21)13(11-12-7-5-6-8-14(12)18)17-16-19(2)9-10-20(16)3/h5-10,13H,4,11,18H2,1-3H3.
What are the key properties of CID 162407125?
CID 162407125 has a molecular weight of 299.18 g/mol, XLogP of 0.36, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162407125 is sourced from PubChem (CID 162407125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).