C31H31F3INO4S — CID 162407162
ethyl 2,2-difluoro-3-[5-(4-fluorophenyl)-4-(2-iodoethyl)-3-methyl-1-(4-methylphenyl)sulfonyl-2H-1-benzazepin-3-yl]propanoate (PubChem CID 162407162) has the molecular formula C31H31F3INO4S and a molecular weight of 697.56 g/mol. Its IUPAC name is ethyl 2,2-difluoro-3-[5-(4-fluorophenyl)-4-(2-iodoethyl)-3-methyl-1-(4-methylphenyl)sulfonyl-2H-1-benzazepin-3-yl]propanoate.
| Compound Name | ethyl 2,2-difluoro-3-[5-(4-fluorophenyl)-4-(2-iodoethyl)-3-methyl-1-(4-methylphenyl)sulfonyl-2H-1-benzazepin-3-yl]propanoate |
|---|---|
| PubChem CID | 162407162 |
| Molecular Formula | C31H31F3INO4S |
| Molecular Weight | 697.56 g/mol |
| Exact Mass | 697.10 |
| IUPAC Name | ethyl 2,2-difluoro-3-[5-(4-fluorophenyl)-4-(2-iodoethyl)-3-methyl-1-(4-methylphenyl)sulfonyl-2H-1-benzazepin-3-yl]propanoate |
| SMILES | CCOC(=O)C(F)(F)CC1(C)CN(S(=O)(=O)c2ccc(C)cc2)c2ccccc2C(c2ccc(F)cc2)=C1CCI |
| InChI | InChI=1S/C31H31F3INO4S/c1-4-40-29(37)31(33,34)19-30(3)20-36(41(38,39)24-15-9-21(2)10-16-24)27-8-6-5-7-25(27)28(26(30)17-18-35)22-11-13-23(32)14-12-22/h5-16H,4,17-20H2,1-3H3 |
| InChIKey | GVBVSHSQVKCNTN-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.56 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|