C28H25F13INO2S — CID 132529781
4-(2-iodoethyl)-3,5-dimethyl-1-(4-methylphenyl)sulfonyl-3-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)-2H-1-benzazepine (PubChem CID 132529781) has the molecular formula C28H25F13INO2S and a molecular weight of 813.46 g/mol. Its IUPAC name is 4-(2-iodoethyl)-3,5-dimethyl-1-(4-methylphenyl)sulfonyl-3-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)-2H-1-benzazepine.
| Compound Name | 4-(2-iodoethyl)-3,5-dimethyl-1-(4-methylphenyl)sulfonyl-3-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)-2H-1-benzazepine |
|---|---|
| PubChem CID | 132529781 |
| Molecular Formula | C28H25F13INO2S |
| Molecular Weight | 813.46 g/mol |
| Exact Mass | 813.04 |
| IUPAC Name | 4-(2-iodoethyl)-3,5-dimethyl-1-(4-methylphenyl)sulfonyl-3-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)-2H-1-benzazepine |
| SMILES | CC1=C(CCI)C(C)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CN(S(=O)(=O)c2ccc(C)cc2)c2ccccc21 |
| InChI | InChI=1S/C28H25F13INO2S/c1-16-8-10-18(11-9-16)46(44,45)43-15-22(3,20(12-13-42)17(2)19-6-4-5-7-21(19)43)14-23(29,30)24(31,32)25(33,34)26(35,36)27(37,38)28(39,40)41/h4-11H,12-15H2,1-3H3 |
| InChIKey | PBYZGMHSVLBRDA-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.46 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|