C19H14F9NO2 — CID 162407719
4-[2-(1,3-benzodioxol-5-yl)-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-yl]pyridine (PubChem CID 162407719) has the molecular formula C19H14F9NO2 and a molecular weight of 459.31 g/mol. Its IUPAC name is 4-[2-(1,3-benzodioxol-5-yl)-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-yl]pyridine.
| Compound Name | 4-[2-(1,3-benzodioxol-5-yl)-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-yl]pyridine |
|---|---|
| PubChem CID | 162407719 |
| Molecular Formula | C19H14F9NO2 |
| Molecular Weight | 459.31 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 4-[2-(1,3-benzodioxol-5-yl)-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-yl]pyridine |
| SMILES | CC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c1ccncc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H14F9NO2/c1-15(11-4-6-29-7-5-11,12-2-3-13-14(8-12)31-10-30-13)9-16(20,21)17(22,23)18(24,25)19(26,27)28/h2-8H,9-10H2,1H3 |
| InChIKey | SSDAYGHJTCWONI-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.31 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|