C13H16O2 — CID 162408658
2-[(E)-2-(2-methylphenyl)ethenyl]-1,4-dioxane (PubChem CID 162408658) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-[(E)-2-(2-methylphenyl)ethenyl]-1,4-dioxane.
| Compound Name | 2-[(E)-2-(2-methylphenyl)ethenyl]-1,4-dioxane |
|---|---|
| PubChem CID | 162408658 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2-[(E)-2-(2-methylphenyl)ethenyl]-1,4-dioxane |
| SMILES | Cc1ccccc1/C=C/C1COCCO1 |
| InChI | InChI=1S/C13H16O2/c1-11-4-2-3-5-12(11)6-7-13-10-14-8-9-15-13/h2-7,13H,8-10H2,1H3/b7-6+ |
| InChIKey | XGRPHTABHLAOKQ-VOTSOKGWSA-N |
| XLogP | 2.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |