C13H20O4 — CID 162408944
(1S,3R,8S,10R)-5,5-dimethyl-2,4,9-trioxatricyclo[8.4.0.03,8]tetradecan-6-one (PubChem CID 162408944) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (1S,3R,8S,10R)-5,5-dimethyl-2,4,9-trioxatricyclo[8.4.0.03,8]tetradecan-6-one.
| Compound Name | (1S,3R,8S,10R)-5,5-dimethyl-2,4,9-trioxatricyclo[8.4.0.03,8]tetradecan-6-one |
|---|---|
| PubChem CID | 162408944 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (1S,3R,8S,10R)-5,5-dimethyl-2,4,9-trioxatricyclo[8.4.0.03,8]tetradecan-6-one |
| SMILES | CC1(C)O[C@H]2O[C@H]3CCCC[C@H]3O[C@H]2CC1=O |
| InChI | InChI=1S/C13H20O4/c1-13(2)11(14)7-10-12(17-13)16-9-6-4-3-5-8(9)15-10/h8-10,12H,3-7H2,1-2H3/t8-,9+,10+,12-/m1/s1 |
| InChIKey | NYGFRFPRVQXFKH-FYLLDIAZSA-N |
| XLogP | 1.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |