C9H12O5 — CID 162409041
ethyl (4aR,7aS)-2,3,4a,7a-tetrahydrofuro[2,3-b][1,4]dioxine-6-carboxylate (PubChem CID 162409041) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is ethyl (4aR,7aS)-2,3,4a,7a-tetrahydrofuro[2,3-b][1,4]dioxine-6-carboxylate.
| Compound Name | ethyl (4aR,7aS)-2,3,4a,7a-tetrahydrofuro[2,3-b][1,4]dioxine-6-carboxylate |
|---|---|
| PubChem CID | 162409041 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | ethyl (4aR,7aS)-2,3,4a,7a-tetrahydrofuro[2,3-b][1,4]dioxine-6-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H]2OCCO[C@@H]2O1 |
| InChI | InChI=1S/C9H12O5/c1-2-11-8(10)6-5-7-9(14-6)13-4-3-12-7/h5,7,9H,2-4H2,1H3/t7-,9+/m0/s1 |
| InChIKey | HPGPENCBPPLXHN-IONNQARKSA-N |
| XLogP | 0.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |