C13H12Br2F3N — CID 162410082
N,N-bis(2-bromoprop-2-enyl)-4-(trifluoromethyl)aniline (PubChem CID 162410082) has the molecular formula C13H12Br2F3N and a molecular weight of 399.05 g/mol. Its IUPAC name is N,N-bis(2-bromoprop-2-enyl)-4-(trifluoromethyl)aniline.
| Compound Name | N,N-bis(2-bromoprop-2-enyl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 162410082 |
| Molecular Formula | C13H12Br2F3N |
| Molecular Weight | 399.05 g/mol |
| Exact Mass | 396.93 |
| IUPAC Name | N,N-bis(2-bromoprop-2-enyl)-4-(trifluoromethyl)aniline |
| SMILES | C=C(Br)CN(CC(=C)Br)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H12Br2F3N/c1-9(14)7-19(8-10(2)15)12-5-3-11(4-6-12)13(16,17)18/h3-6H,1-2,7-8H2 |
| InChIKey | VBUAAKBCUHHZCY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.05 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |