C8H5F2NO4S — CID 162410559
2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole (PubChem CID 162410559) has the molecular formula C8H5F2NO4S and a molecular weight of 249.19 g/mol. Its IUPAC name is 2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole.
| Compound Name | 2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole |
|---|---|
| PubChem CID | 162410559 |
| Molecular Formula | C8H5F2NO4S |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | 2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole |
| SMILES | COc1cc2c(c([N+](=O)[O-])c1)OC(F)(F)S2 |
| InChI | InChI=1S/C8H5F2NO4S/c1-14-4-2-5(11(12)13)7-6(3-4)16-8(9,10)15-7/h2-3H,1H3 |
| InChIKey | YIQLTVMDIOJZQV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|