About 2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole
2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole (PubChem CID 162410559) has the molecular formula C8H5F2NO4S
and a molecular weight of 249.19 g/mol. Its IUPAC name is 2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole.
Molecular Properties
| Compound Name | 2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole |
| PubChem CID | 162410559 |
| Molecular Formula | C8H5F2NO4S |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | 2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole |
| SMILES | COc1cc2c(c([N+](=O)[O-])c1)OC(F)(F)S2 |
| InChI | InChI=1S/C8H5F2NO4S/c1-14-4-2-5(11(12)13)7-6(3-4)16-8(9,10)15-7/h2-3H,1H3 |
| InChIKey | YIQLTVMDIOJZQV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole?
The IUPAC name of 2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole (CID 162410559) is 2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole.
What is the SMILES notation for 2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole?
The canonical SMILES for 2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole is COc1cc2c(c([N+](=O)[O-])c1)OC(F)(F)S2.
What is the InChIKey of 2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole?
The InChIKey is YIQLTVMDIOJZQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F2NO4S/c1-14-4-2-5(11(12)13)7-6(3-4)16-8(9,10)15-7/h2-3H,1H3.
What are the key properties of 2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole?
2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole has a molecular weight of 249.19 g/mol, XLogP of 2.64, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-5-methoxy-7-nitro-1,3-benzoxathiole is sourced from PubChem (CID 162410559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).