C26H28O6 — CID 162410653
(E)-1,3-bis(3,5-dimethoxyphenyl)-2-(4-methoxyphenyl)prop-2-en-1-ol (PubChem CID 162410653) has the molecular formula C26H28O6 and a molecular weight of 436.50 g/mol. Its IUPAC name is (E)-1,3-bis(3,5-dimethoxyphenyl)-2-(4-methoxyphenyl)prop-2-en-1-ol.
| Compound Name | (E)-1,3-bis(3,5-dimethoxyphenyl)-2-(4-methoxyphenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 162410653 |
| Molecular Formula | C26H28O6 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (E)-1,3-bis(3,5-dimethoxyphenyl)-2-(4-methoxyphenyl)prop-2-en-1-ol |
| SMILES | COc1ccc(/C(=C\c2cc(OC)cc(OC)c2)C(O)c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C26H28O6/c1-28-20-8-6-18(7-9-20)25(12-17-10-21(29-2)15-22(11-17)30-3)26(27)19-13-23(31-4)16-24(14-19)32-5/h6-16,26-27H,1-5H3/b25-12+ |
| InChIKey | YSZLLTLFPVZGDH-BRJLIKDPSA-N |
| XLogP | 5.00 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|