C16H16O8P-3 — CID 19390355
2-(3,5-dimethoxyphenyl)-2-hydroxy-1-phenylethanone phosphate (PubChem CID 19390355) has the molecular formula C16H16O8P-3 and a molecular weight of 367.27 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-2-hydroxy-1-phenylethanone phosphate.
| Compound Name | 2-(3,5-dimethoxyphenyl)-2-hydroxy-1-phenylethanone phosphate |
|---|---|
| PubChem CID | 19390355 |
| Molecular Formula | C16H16O8P-3 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-2-hydroxy-1-phenylethanone phosphate |
| SMILES | COc1cc(OC)cc(C(O)C(=O)c2ccccc2)c1.O=P([O-])([O-])[O-] |
| InChI | InChI=1S/C16H16O4.H3O4P/c1-19-13-8-12(9-14(10-13)20-2)16(18)15(17)11-6-4-3-5-7-11;1-5(2,3)4/h3-10,16,18H,1-2H3;(H3,1,2,3,4)/p-3 |
| InChIKey | DRINDTYOBNMGEA-UHFFFAOYSA-K |
| XLogP | -0.20 |
| TPSA | 142.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|