C23H41F3O6Si3 — CID 162411642
trimethyl-[2,2,2-trifluoro-1-[(2S,3R,4S,5S)-5-methoxy-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-1-phenylmethoxyethoxy]silane (PubChem CID 162411642) has the molecular formula C23H41F3O6Si3 and a molecular weight of 554.83 g/mol. Its IUPAC name is trimethyl-[2,2,2-trifluoro-1-[(2S,3R,4S,5S)-5-methoxy-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-1-phenylmethoxyethoxy]silane.
| Compound Name | trimethyl-[2,2,2-trifluoro-1-[(2S,3R,4S,5S)-5-methoxy-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-1-phenylmethoxyethoxy]silane |
|---|---|
| PubChem CID | 162411642 |
| Molecular Formula | C23H41F3O6Si3 |
| Molecular Weight | 554.83 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | trimethyl-[2,2,2-trifluoro-1-[(2S,3R,4S,5S)-5-methoxy-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-1-phenylmethoxyethoxy]silane |
| SMILES | CO[C@H]1O[C@H](C(OCc2ccccc2)(O[Si](C)(C)C)C(F)(F)F)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C23H41F3O6Si3/c1-27-21-19(31-34(5,6)7)18(30-33(2,3)4)20(29-21)22(23(24,25)26,32-35(8,9)10)28-16-17-14-12-11-13-15-17/h11-15,18-21H,16H2,1-10H3/t18-,19-,20-,21-,22?/m0/s1 |
| InChIKey | OEQOFQRTDZRWBM-MMMKYPTOSA-N |
| XLogP | 6.12 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.83 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|