C21H26BrNO6 — CID 162412200
methyl (2S)-1-(4-bromophenyl)-4,5-bis(propanoyloxymethyl)-3,6-dihydro-2H-pyridine-2-carboxylate (PubChem CID 162412200) has the molecular formula C21H26BrNO6 and a molecular weight of 468.34 g/mol. Its IUPAC name is methyl (2S)-1-(4-bromophenyl)-4,5-bis(propanoyloxymethyl)-3,6-dihydro-2H-pyridine-2-carboxylate.
| Compound Name | methyl (2S)-1-(4-bromophenyl)-4,5-bis(propanoyloxymethyl)-3,6-dihydro-2H-pyridine-2-carboxylate |
|---|---|
| PubChem CID | 162412200 |
| Molecular Formula | C21H26BrNO6 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | methyl (2S)-1-(4-bromophenyl)-4,5-bis(propanoyloxymethyl)-3,6-dihydro-2H-pyridine-2-carboxylate |
| SMILES | CCC(=O)OCC1=C(COC(=O)CC)CN(c2ccc(Br)cc2)[C@H](C(=O)OC)C1 |
| InChI | InChI=1S/C21H26BrNO6/c1-4-19(24)28-12-14-10-18(21(26)27-3)23(17-8-6-16(22)7-9-17)11-15(14)13-29-20(25)5-2/h6-9,18H,4-5,10-13H2,1-3H3/t18-/m0/s1 |
| InChIKey | OZYRDGGTARZNTP-SFHVURJKSA-N |
| XLogP | 3.40 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|