C19H24BrNO2 — CID 162412199
methyl (2S)-1-(4-bromophenyl)-4-(4-methylpent-3-enyl)-3,6-dihydro-2H-pyridine-2-carboxylate (PubChem CID 162412199) has the molecular formula C19H24BrNO2 and a molecular weight of 378.31 g/mol. Its IUPAC name is methyl (2S)-1-(4-bromophenyl)-4-(4-methylpent-3-enyl)-3,6-dihydro-2H-pyridine-2-carboxylate.
| Compound Name | methyl (2S)-1-(4-bromophenyl)-4-(4-methylpent-3-enyl)-3,6-dihydro-2H-pyridine-2-carboxylate |
|---|---|
| PubChem CID | 162412199 |
| Molecular Formula | C19H24BrNO2 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | methyl (2S)-1-(4-bromophenyl)-4-(4-methylpent-3-enyl)-3,6-dihydro-2H-pyridine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(CCC=C(C)C)=CCN1c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H24BrNO2/c1-14(2)5-4-6-15-11-12-21(18(13-15)19(22)23-3)17-9-7-16(20)8-10-17/h5,7-11,18H,4,6,12-13H2,1-3H3/t18-/m0/s1 |
| InChIKey | NDPSVMIJIRODRW-SFHVURJKSA-N |
| XLogP | 4.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|