C14H15BrF3NO2 — CID 115538322
methyl 1-[4-bromo-2-(trifluoromethyl)phenyl]piperidine-2-carboxylate (PubChem CID 115538322) has the molecular formula C14H15BrF3NO2 and a molecular weight of 366.18 g/mol. Its IUPAC name is methyl 1-[4-bromo-2-(trifluoromethyl)phenyl]piperidine-2-carboxylate.
| Compound Name | methyl 1-[4-bromo-2-(trifluoromethyl)phenyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 115538322 |
| Molecular Formula | C14H15BrF3NO2 |
| Molecular Weight | 366.18 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | methyl 1-[4-bromo-2-(trifluoromethyl)phenyl]piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H15BrF3NO2/c1-21-13(20)12-4-2-3-7-19(12)11-6-5-9(15)8-10(11)14(16,17)18/h5-6,8,12H,2-4,7H2,1H3 |
| InChIKey | PZEYQVOOCPXOSS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.18 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |