C12H16N2O2 — CID 53402483
methyl 1-(2-aminophenyl)pyrrolidine-2-carboxylate (PubChem CID 53402483) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is methyl 1-(2-aminophenyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(2-aminophenyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 53402483 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | methyl 1-(2-aminophenyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1c1ccccc1N |
| InChI | InChI=1S/C12H16N2O2/c1-16-12(15)11-7-4-8-14(11)10-6-3-2-5-9(10)13/h2-3,5-6,11H,4,7-8,13H2,1H3 |
| InChIKey | BHWHIJMLKQNHPK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|