C25H29BBrNO4 — CID 162412198
methyl (2S)-1-(4-bromophenyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,6-dihydro-2H-pyridine-2-carboxylate (PubChem CID 162412198) has the molecular formula C25H29BBrNO4 and a molecular weight of 498.23 g/mol. Its IUPAC name is methyl (2S)-1-(4-bromophenyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,6-dihydro-2H-pyridine-2-carboxylate.
| Compound Name | methyl (2S)-1-(4-bromophenyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,6-dihydro-2H-pyridine-2-carboxylate |
|---|---|
| PubChem CID | 162412198 |
| Molecular Formula | C25H29BBrNO4 |
| Molecular Weight | 498.23 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | methyl (2S)-1-(4-bromophenyl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,6-dihydro-2H-pyridine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)=CCN1c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H29BBrNO4/c1-24(2)25(3,4)32-26(31-24)19-8-6-17(7-9-19)18-14-15-28(22(16-18)23(29)30-5)21-12-10-20(27)11-13-21/h6-14,22H,15-16H2,1-5H3/t22-/m0/s1 |
| InChIKey | LWYYDGYGSSVPER-QFIPXVFZSA-N |
| XLogP | 4.58 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.23 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|