C12H16O3 — CID 162412661
(3S,3aR,6aR)-3-(4-hydroxybutyl)-2,3,3a,6a-tetrahydropentalene-1,4-dione (PubChem CID 162412661) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (3S,3aR,6aR)-3-(4-hydroxybutyl)-2,3,3a,6a-tetrahydropentalene-1,4-dione.
| Compound Name | (3S,3aR,6aR)-3-(4-hydroxybutyl)-2,3,3a,6a-tetrahydropentalene-1,4-dione |
|---|---|
| PubChem CID | 162412661 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (3S,3aR,6aR)-3-(4-hydroxybutyl)-2,3,3a,6a-tetrahydropentalene-1,4-dione |
| SMILES | O=C1C=C[C@H]2C(=O)C[C@H](CCCCO)[C@@H]12 |
| InChI | InChI=1S/C12H16O3/c13-6-2-1-3-8-7-11(15)9-4-5-10(14)12(8)9/h4-5,8-9,12-13H,1-3,6-7H2/t8-,9-,12+/m0/s1 |
| InChIKey | RJNOXMFVPHGZCC-HOTUBEGUSA-N |
| XLogP | 1.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|