(9E)-11-hydroxy-2,4,6,10-tetramethylundeca-5,9-dienoic acid

C15H26O3 — CID 162413012

IUPAC(9E)-11-hydroxy-2,4,6,10-tetramethylundeca-5,9-dienoic acid
SMILESCC(=CC(C)CC(C)C(=O)O)CC/C=C(\C)CO
InChIInChI=1S/C15H26O3/c1-11(6-5-7-12(2)10-16)8-13(3)9-14(4)15(17)18/h7-8,13-14,16H,5-6,9-10H2,1-4H3,(H,17,18)/b11-8?,12-7+
InChIKeyNELMRACUISQGNV-HLZGRMLGSA-N
MW254.37 g/mol
LogP3.40
Rot. Bonds8

About (9E)-11-hydroxy-2,4,6,10-tetramethylundeca-5,9-dienoic acid

(9E)-11-hydroxy-2,4,6,10-tetramethylundeca-5,9-dienoic acid (PubChem CID 162413012) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (9E)-11-hydroxy-2,4,6,10-tetramethylundeca-5,9-dienoic acid.

Molecular Properties

Compound Name(9E)-11-hydroxy-2,4,6,10-tetramethylundeca-5,9-dienoic acid
PubChem CID162413012
Molecular FormulaC15H26O3
Molecular Weight254.37 g/mol
Exact Mass254.19
IUPAC Name(9E)-11-hydroxy-2,4,6,10-tetramethylundeca-5,9-dienoic acid
SMILESCC(=CC(C)CC(C)C(=O)O)CC/C=C(\C)CO
InChIInChI=1S/C15H26O3/c1-11(6-5-7-12(2)10-16)8-13(3)9-14(4)15(17)18/h7-8,13-14,16H,5-6,9-10H2,1-4H3,(H,17,18)/b11-8?,12-7+
InChIKeyNELMRACUISQGNV-HLZGRMLGSA-N
XLogP3.40
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.37
LogP ≤ 53.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (9E)-11-hydroxy-2,4,6,10-tetramethylundeca-5,9-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (9E)-11-hydroxy-2,4,6,10-tetramethylundeca-5,9-dienoic acid?
The IUPAC name of (9E)-11-hydroxy-2,4,6,10-tetramethylundeca-5,9-dienoic acid (CID 162413012) is (9E)-11-hydroxy-2,4,6,10-tetramethylundeca-5,9-dienoic acid.
What is the SMILES notation for (9E)-11-hydroxy-2,4,6,10-tetramethylundeca-5,9-dienoic acid?
The canonical SMILES for (9E)-11-hydroxy-2,4,6,10-tetramethylundeca-5,9-dienoic acid is CC(=CC(C)CC(C)C(=O)O)CC/C=C(\C)CO.
What is the InChIKey of (9E)-11-hydroxy-2,4,6,10-tetramethylundeca-5,9-dienoic acid?
The InChIKey is NELMRACUISQGNV-HLZGRMLGSA-N. The full InChI is InChI=1S/C15H26O3/c1-11(6-5-7-12(2)10-16)8-13(3)9-14(4)15(17)18/h7-8,13-14,16H,5-6,9-10H2,1-4H3,(H,17,18)/b11-8?,12-7+.
What are the key properties of (9E)-11-hydroxy-2,4,6,10-tetramethylundeca-5,9-dienoic acid?
(9E)-11-hydroxy-2,4,6,10-tetramethylundeca-5,9-dienoic acid has a molecular weight of 254.37 g/mol, XLogP of 3.40, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (9E)-11-hydroxy-2,4,6,10-tetramethylundeca-5,9-dienoic acid is sourced from PubChem (CID 162413012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).