C16H18F3NS — CID 162414843
2,3-dipropyl-4-(trifluoromethyl)-1,5-benzothiazepine (PubChem CID 162414843) has the molecular formula C16H18F3NS and a molecular weight of 313.39 g/mol. Its IUPAC name is 2,3-dipropyl-4-(trifluoromethyl)-1,5-benzothiazepine.
| Compound Name | 2,3-dipropyl-4-(trifluoromethyl)-1,5-benzothiazepine |
|---|---|
| PubChem CID | 162414843 |
| Molecular Formula | C16H18F3NS |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2,3-dipropyl-4-(trifluoromethyl)-1,5-benzothiazepine |
| SMILES | CCCC1=C(CCC)C(C(F)(F)F)=Nc2ccccc2S1 |
| InChI | InChI=1S/C16H18F3NS/c1-3-7-11-13(8-4-2)21-14-10-6-5-9-12(14)20-15(11)16(17,18)19/h5-6,9-10H,3-4,7-8H2,1-2H3 |
| InChIKey | YZHDVKJREZYABN-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |