C14H16F2INO3 — CID 162415541
ethyl 4-acetamido-2,2-difluoro-4-(4-iodophenyl)butanoate (PubChem CID 162415541) has the molecular formula C14H16F2INO3 and a molecular weight of 411.19 g/mol. Its IUPAC name is ethyl 4-acetamido-2,2-difluoro-4-(4-iodophenyl)butanoate.
| Compound Name | ethyl 4-acetamido-2,2-difluoro-4-(4-iodophenyl)butanoate |
|---|---|
| PubChem CID | 162415541 |
| Molecular Formula | C14H16F2INO3 |
| Molecular Weight | 411.19 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | ethyl 4-acetamido-2,2-difluoro-4-(4-iodophenyl)butanoate |
| SMILES | CCOC(=O)C(F)(F)CC(NC(C)=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H16F2INO3/c1-3-21-13(20)14(15,16)8-12(18-9(2)19)10-4-6-11(17)7-5-10/h4-7,12H,3,8H2,1-2H3,(H,18,19) |
| InChIKey | YDQCXBKAZAFSAO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.19 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|