C16H22O6 — CID 162416205
ethyl (Z)-2-(2,6-dimethoxyphenyl)-4-ethoxy-3-hydroxybut-2-enoate (PubChem CID 162416205) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is ethyl (Z)-2-(2,6-dimethoxyphenyl)-4-ethoxy-3-hydroxybut-2-enoate.
| Compound Name | ethyl (Z)-2-(2,6-dimethoxyphenyl)-4-ethoxy-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 162416205 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | ethyl (Z)-2-(2,6-dimethoxyphenyl)-4-ethoxy-3-hydroxybut-2-enoate |
| SMILES | CCOC/C(O)=C(/C(=O)OCC)c1c(OC)cccc1OC |
| InChI | InChI=1S/C16H22O6/c1-5-21-10-11(17)14(16(18)22-6-2)15-12(19-3)8-7-9-13(15)20-4/h7-9,17H,5-6,10H2,1-4H3/b14-11- |
| InChIKey | AFUAGMUIUJVWPX-KAMYIIQDSA-N |
| XLogP | 2.57 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|