C20H28O4 — CID 162416973
(1S,4R,7R,9S)-7,11-dihydroxy-5,5-dimethyl-13-propan-2-yl-15-oxatetracyclo[7.5.2.01,10.04,9]hexadeca-10,13-dien-12-one (PubChem CID 162416973) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (1S,4R,7R,9S)-7,11-dihydroxy-5,5-dimethyl-13-propan-2-yl-15-oxatetracyclo[7.5.2.01,10.04,9]hexadeca-10,13-dien-12-one.
| Compound Name | (1S,4R,7R,9S)-7,11-dihydroxy-5,5-dimethyl-13-propan-2-yl-15-oxatetracyclo[7.5.2.01,10.04,9]hexadeca-10,13-dien-12-one |
|---|---|
| PubChem CID | 162416973 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (1S,4R,7R,9S)-7,11-dihydroxy-5,5-dimethyl-13-propan-2-yl-15-oxatetracyclo[7.5.2.01,10.04,9]hexadeca-10,13-dien-12-one |
| SMILES | CC(C)C1=C[C@]23CC[C@@H]4C(C)(C)C[C@@H](O)C[C@@]4(CO2)C3=C(O)C1=O |
| InChI | InChI=1S/C20H28O4/c1-11(2)13-9-20-6-5-14-18(3,4)7-12(21)8-19(14,10-24-20)17(20)16(23)15(13)22/h9,11-12,14,21,23H,5-8,10H2,1-4H3/t12-,14-,19+,20+/m1/s1 |
| InChIKey | CPRUNGZHPSEUQK-ZALBTGBISA-N |
| XLogP | 3.31 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |