C22H28O8 — CID 20979833
[5,6,8,10-tetrahydroxy-7-(1-hydroxypropan-2-yl)-1,1,4a-trimethyl-9-oxo-3,4-dihydro-2H-phenanthren-2-yl] acetate (PubChem CID 20979833) has the molecular formula C22H28O8 and a molecular weight of 420.46 g/mol. Its IUPAC name is [5,6,8,10-tetrahydroxy-7-(1-hydroxypropan-2-yl)-1,1,4a-trimethyl-9-oxo-3,4-dihydro-2H-phenanthren-2-yl] acetate.
| Compound Name | [5,6,8,10-tetrahydroxy-7-(1-hydroxypropan-2-yl)-1,1,4a-trimethyl-9-oxo-3,4-dihydro-2H-phenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 20979833 |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [5,6,8,10-tetrahydroxy-7-(1-hydroxypropan-2-yl)-1,1,4a-trimethyl-9-oxo-3,4-dihydro-2H-phenanthren-2-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C(=C(O)C(=O)c3c(O)c(C(C)CO)c(O)c(O)c32)C1(C)C |
| InChI | InChI=1S/C22H28O8/c1-9(8-23)12-15(25)13-14(18(28)16(12)26)22(5)7-6-11(30-10(2)24)21(3,4)20(22)19(29)17(13)27/h9,11,23,25-26,28-29H,6-8H2,1-5H3 |
| InChIKey | MJCCDVKRNHYYMN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|