C12H10O7 — CID 135457951
6-ethyl-2,3,5,7,8-pentahydroxynaphthalene-1,4-dione (PubChem CID 135457951) has the molecular formula C12H10O7 and a molecular weight of 266.20 g/mol. Its IUPAC name is 6-ethyl-2,3,5,7,8-pentahydroxynaphthalene-1,4-dione.
| Compound Name | 6-ethyl-2,3,5,7,8-pentahydroxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 135457951 |
| Molecular Formula | C12H10O7 |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 6-ethyl-2,3,5,7,8-pentahydroxynaphthalene-1,4-dione |
| SMILES | CCc1c(O)c(O)c2c(c1O)C(=O)C(O)=C(O)C2=O |
| InChI | InChI=1S/C12H10O7/c1-2-3-6(13)4-5(8(15)7(3)14)10(17)12(19)11(18)9(4)16/h13-15,18-19H,2H2,1H3 |
| InChIKey | DNRFNICCPHGYAX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|