C28H39NO6Si — CID 162417428
methyl (3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]-3-phenylpropanoate (PubChem CID 162417428) has the molecular formula C28H39NO6Si and a molecular weight of 513.71 g/mol. Its IUPAC name is methyl (3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]-3-phenylpropanoate.
| Compound Name | methyl (3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 162417428 |
| Molecular Formula | C28H39NO6Si |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | methyl (3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]-3-phenylpropanoate |
| SMILES | COC(=O)C([C@@H](c1ccccc1)[Si](C)(C)c1ccccc1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H39NO6Si/c1-27(2,3)34-25(31)29(26(32)35-28(4,5)6)22(24(30)33-7)23(20-16-12-10-13-17-20)36(8,9)21-18-14-11-15-19-21/h10-19,22-23H,1-9H3/t22?,23-/m1/s1 |
| InChIKey | LIKZXTTWYPGVSH-OZAIVSQSSA-N |
| XLogP | 5.64 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|