C29H41NO6Si — CID 162417429
methyl (3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]-4-phenylbutanoate (PubChem CID 162417429) has the molecular formula C29H41NO6Si and a molecular weight of 527.73 g/mol. Its IUPAC name is methyl (3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]-4-phenylbutanoate.
| Compound Name | methyl (3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]-4-phenylbutanoate |
|---|---|
| PubChem CID | 162417429 |
| Molecular Formula | C29H41NO6Si |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | methyl (3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]-4-phenylbutanoate |
| SMILES | COC(=O)C([C@@H](Cc1ccccc1)[Si](C)(C)c1ccccc1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H41NO6Si/c1-28(2,3)35-26(32)30(27(33)36-29(4,5)6)24(25(31)34-7)23(20-21-16-12-10-13-17-21)37(8,9)22-18-14-11-15-19-22/h10-19,23-24H,20H2,1-9H3/t23-,24?/m1/s1 |
| InChIKey | VDRFELFNNFKYPQ-MIHMCVIASA-N |
| XLogP | 5.93 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|