C13H22OSi — CID 162417900
[(1R,5S)-6,6-dimethyl-4-methylidene-2-bicyclo[3.1.1]hept-2-enyl]oxy-trimethylsilane (PubChem CID 162417900) has the molecular formula C13H22OSi and a molecular weight of 222.40 g/mol. Its IUPAC name is [(1R,5S)-6,6-dimethyl-4-methylidene-2-bicyclo[3.1.1]hept-2-enyl]oxy-trimethylsilane.
| Compound Name | [(1R,5S)-6,6-dimethyl-4-methylidene-2-bicyclo[3.1.1]hept-2-enyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 162417900 |
| Molecular Formula | C13H22OSi |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | [(1R,5S)-6,6-dimethyl-4-methylidene-2-bicyclo[3.1.1]hept-2-enyl]oxy-trimethylsilane |
| SMILES | C=C1C=C(O[Si](C)(C)C)[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C13H22OSi/c1-9-7-12(14-15(4,5)6)11-8-10(9)13(11,2)3/h7,10-11H,1,8H2,2-6H3/t10-,11+/m1/s1 |
| InChIKey | HMGXLHPXPOQAFQ-MNOVXSKESA-N |
| XLogP | 3.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|