C17H21NO5S — CID 162418012
methyl 2-[(4Z)-4-ethylidene-3-methyl-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidin-3-yl]acetate (PubChem CID 162418012) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is methyl 2-[(4Z)-4-ethylidene-3-methyl-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidin-3-yl]acetate.
| Compound Name | methyl 2-[(4Z)-4-ethylidene-3-methyl-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 162418012 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | methyl 2-[(4Z)-4-ethylidene-3-methyl-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidin-3-yl]acetate |
| SMILES | C/C=C1\C(=O)N(S(=O)(=O)c2ccc(C)cc2)CC1(C)CC(=O)OC |
| InChI | InChI=1S/C17H21NO5S/c1-5-14-16(20)18(11-17(14,3)10-15(19)23-4)24(21,22)13-8-6-12(2)7-9-13/h5-9H,10-11H2,1-4H3/b14-5+ |
| InChIKey | IMBCMISRRFVRGS-LHHJGKSTSA-N |
| XLogP | 2.04 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|