C20H35IOSi — CID 162418357
[(3aR,4S,7aS)-1-(4-iodobut-1-enylidene)-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 162418357) has the molecular formula C20H35IOSi and a molecular weight of 446.49 g/mol. Its IUPAC name is [(3aR,4S,7aS)-1-(4-iodobut-1-enylidene)-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4S,7aS)-1-(4-iodobut-1-enylidene)-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 162418357 |
| Molecular Formula | C20H35IOSi |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | [(3aR,4S,7aS)-1-(4-iodobut-1-enylidene)-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@]2(C)C(=C=CCCI)CC[C@@H]12 |
| InChI | InChI=1S/C20H35IOSi/c1-19(2,3)23(5,6)22-18-11-9-14-20(4)16(10-7-8-15-21)12-13-17(18)20/h7,17-18H,8-9,11-15H2,1-6H3/t10?,17-,18-,20+/m0/s1 |
| InChIKey | AVJMFEBXMDMMHJ-BUTBUNECSA-N |
| XLogP | 6.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|