C23H34O2 — CID 162418399
(7S,10R,13S)-5,5,10,13-tetramethyl-14-propan-2-yl-4,6-dioxatetracyclo[8.8.0.02,7.013,17]octadeca-1,14,17-triene (PubChem CID 162418399) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is (7S,10R,13S)-5,5,10,13-tetramethyl-14-propan-2-yl-4,6-dioxatetracyclo[8.8.0.02,7.013,17]octadeca-1,14,17-triene.
| Compound Name | (7S,10R,13S)-5,5,10,13-tetramethyl-14-propan-2-yl-4,6-dioxatetracyclo[8.8.0.02,7.013,17]octadeca-1,14,17-triene |
|---|---|
| PubChem CID | 162418399 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | (7S,10R,13S)-5,5,10,13-tetramethyl-14-propan-2-yl-4,6-dioxatetracyclo[8.8.0.02,7.013,17]octadeca-1,14,17-triene |
| SMILES | CC(C)C1=CCC2=CC3=C4COC(C)(C)O[C@H]4CC[C@@]3(C)CC[C@@]21C |
| InChI | InChI=1S/C23H34O2/c1-15(2)18-8-7-16-13-19-17-14-24-21(3,4)25-20(17)9-10-22(19,5)11-12-23(16,18)6/h8,13,15,20H,7,9-12,14H2,1-6H3/t20-,22-,23-/m0/s1 |
| InChIKey | OGNTWFMPYPDGHS-PMVMPFDFSA-N |
| XLogP | 5.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|