C11H10F2O2 — CID 162419086
1-[4-(1,1-difluoroprop-2-enoxy)phenyl]ethanone (PubChem CID 162419086) has the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. Its IUPAC name is 1-[4-(1,1-difluoroprop-2-enoxy)phenyl]ethanone.
| Compound Name | 1-[4-(1,1-difluoroprop-2-enoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 162419086 |
| Molecular Formula | C11H10F2O2 |
| Molecular Weight | 212.19 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 1-[4-(1,1-difluoroprop-2-enoxy)phenyl]ethanone |
| SMILES | C=CC(F)(F)Oc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C11H10F2O2/c1-3-11(12,13)15-10-6-4-9(5-7-10)8(2)14/h3-7H,1H2,2H3 |
| InChIKey | SNQJUHISQNQDMA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.19 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|