C19H20F2O2 — CID 162419488
6,6-difluoro-5-(4-methoxyphenyl)-2-phenylhex-5-en-3-ol (PubChem CID 162419488) has the molecular formula C19H20F2O2 and a molecular weight of 318.36 g/mol. Its IUPAC name is 6,6-difluoro-5-(4-methoxyphenyl)-2-phenylhex-5-en-3-ol.
| Compound Name | 6,6-difluoro-5-(4-methoxyphenyl)-2-phenylhex-5-en-3-ol |
|---|---|
| PubChem CID | 162419488 |
| Molecular Formula | C19H20F2O2 |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 6,6-difluoro-5-(4-methoxyphenyl)-2-phenylhex-5-en-3-ol |
| SMILES | COc1ccc(C(CC(O)C(C)c2ccccc2)=C(F)F)cc1 |
| InChI | InChI=1S/C19H20F2O2/c1-13(14-6-4-3-5-7-14)18(22)12-17(19(20)21)15-8-10-16(23-2)11-9-15/h3-11,13,18,22H,12H2,1-2H3 |
| InChIKey | QWLUBURXTKQNJC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |