C12H17NO — CID 162419740
(9Z)-10-ethenyl-2,3,5,7,8,10a-hexahydro-1H-pyrrolo[1,2-a]azocin-6-one (PubChem CID 162419740) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (9Z)-10-ethenyl-2,3,5,7,8,10a-hexahydro-1H-pyrrolo[1,2-a]azocin-6-one.
| Compound Name | (9Z)-10-ethenyl-2,3,5,7,8,10a-hexahydro-1H-pyrrolo[1,2-a]azocin-6-one |
|---|---|
| PubChem CID | 162419740 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (9Z)-10-ethenyl-2,3,5,7,8,10a-hexahydro-1H-pyrrolo[1,2-a]azocin-6-one |
| SMILES | C=C/C1=C/CCC(=O)CN2CCCC12 |
| InChI | InChI=1S/C12H17NO/c1-2-10-5-3-6-11(14)9-13-8-4-7-12(10)13/h2,5,12H,1,3-4,6-9H2/b10-5- |
| InChIKey | WAJPYQGOFAKQMC-YHYXMXQVSA-N |
| XLogP | 1.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |