C16H27NO — CID 142819934
ethane;1-[5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1-methylpyrrolidin-2-yl]ethanone (PubChem CID 142819934) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is ethane;1-[5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1-methylpyrrolidin-2-yl]ethanone.
| Compound Name | ethane;1-[5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1-methylpyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 142819934 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | ethane;1-[5-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1-methylpyrrolidin-2-yl]ethanone |
| SMILES | C=C/C=C\C=C(/C)C1CCC(C(C)=O)N1C.CC |
| InChI | InChI=1S/C14H21NO.C2H6/c1-5-6-7-8-11(2)13-9-10-14(12(3)16)15(13)4;1-2/h5-8,13-14H,1,9-10H2,2-4H3;1-2H3/b7-6-,11-8+; |
| InChIKey | ZBAMLCPEZRXNLZ-DWROGWBBSA-N |
| XLogP | 3.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|