C14H23NO — CID 142434257
2-ethyl-1-propyl-1-azaspiro[4.5]dec-9-en-6-one (PubChem CID 142434257) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 2-ethyl-1-propyl-1-azaspiro[4.5]dec-9-en-6-one.
| Compound Name | 2-ethyl-1-propyl-1-azaspiro[4.5]dec-9-en-6-one |
|---|---|
| PubChem CID | 142434257 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 2-ethyl-1-propyl-1-azaspiro[4.5]dec-9-en-6-one |
| SMILES | CCCN1C(CC)CCC12C=CCCC2=O |
| InChI | InChI=1S/C14H23NO/c1-3-11-15-12(4-2)8-10-14(15)9-6-5-7-13(14)16/h6,9,12H,3-5,7-8,10-11H2,1-2H3 |
| InChIKey | GPBQHXRTDUMWPZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|