C21H35NO — CID 134979913
1-[(1R,6S)-6-(2,6-dimethylhept-5-enyl)-2-pyrrolidin-1-ylcyclohex-3-en-1-yl]ethanone (PubChem CID 134979913) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is 1-[(1R,6S)-6-(2,6-dimethylhept-5-enyl)-2-pyrrolidin-1-ylcyclohex-3-en-1-yl]ethanone.
| Compound Name | 1-[(1R,6S)-6-(2,6-dimethylhept-5-enyl)-2-pyrrolidin-1-ylcyclohex-3-en-1-yl]ethanone |
|---|---|
| PubChem CID | 134979913 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | 1-[(1R,6S)-6-(2,6-dimethylhept-5-enyl)-2-pyrrolidin-1-ylcyclohex-3-en-1-yl]ethanone |
| SMILES | CC(=O)[C@H]1C(N2CCCC2)C=CC[C@@H]1CC(C)CCC=C(C)C |
| InChI | InChI=1S/C21H35NO/c1-16(2)9-7-10-17(3)15-19-11-8-12-20(21(19)18(4)23)22-13-5-6-14-22/h8-9,12,17,19-21H,5-7,10-11,13-15H2,1-4H3/t17?,19-,20?,21-/m1/s1 |
| InChIKey | VRZSOFVCXDGDQN-BCKAPOECSA-N |
| XLogP | 5.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|