C18H32NO+ — CID 90760428
cyclohexyl-(1,1-dimethyl-2-propan-2-yl-2,3,6,7-tetrahydroazepin-1-ium-3-yl)methanone (PubChem CID 90760428) has the molecular formula C18H32NO+ and a molecular weight of 278.46 g/mol. Its IUPAC name is cyclohexyl-(1,1-dimethyl-2-propan-2-yl-2,3,6,7-tetrahydroazepin-1-ium-3-yl)methanone.
| Compound Name | cyclohexyl-(1,1-dimethyl-2-propan-2-yl-2,3,6,7-tetrahydroazepin-1-ium-3-yl)methanone |
|---|---|
| PubChem CID | 90760428 |
| Molecular Formula | C18H32NO+ |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | cyclohexyl-(1,1-dimethyl-2-propan-2-yl-2,3,6,7-tetrahydroazepin-1-ium-3-yl)methanone |
| SMILES | CC(C)C1C(C(=O)C2CCCCC2)C=CCC[N+]1(C)C |
| InChI | InChI=1S/C18H32NO/c1-14(2)17-16(12-8-9-13-19(17,3)4)18(20)15-10-6-5-7-11-15/h8,12,14-17H,5-7,9-11,13H2,1-4H3/q+1 |
| InChIKey | NYBFNQIPMGBASG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|