C10H15NO — CID 20678651
1-(2,3,3a,4,5,7a-hexahydro-1H-indol-2-yl)ethanone (PubChem CID 20678651) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 1-(2,3,3a,4,5,7a-hexahydro-1H-indol-2-yl)ethanone.
| Compound Name | 1-(2,3,3a,4,5,7a-hexahydro-1H-indol-2-yl)ethanone |
|---|---|
| PubChem CID | 20678651 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 1-(2,3,3a,4,5,7a-hexahydro-1H-indol-2-yl)ethanone |
| SMILES | CC(=O)C1CC2CCC=CC2N1 |
| InChI | InChI=1S/C10H15NO/c1-7(12)10-6-8-4-2-3-5-9(8)11-10/h3,5,8-11H,2,4,6H2,1H3 |
| InChIKey | QEGDDMHFTOMKTD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|