C9H9BrN2 — CID 162421604
5-bromo-2,8-dimethylimidazo[1,2-a]pyridine (PubChem CID 162421604) has the molecular formula C9H9BrN2 and a molecular weight of 225.09 g/mol. Its IUPAC name is 5-bromo-2,8-dimethylimidazo[1,2-a]pyridine.
| Compound Name | 5-bromo-2,8-dimethylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 162421604 |
| Molecular Formula | C9H9BrN2 |
| Molecular Weight | 225.09 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 5-bromo-2,8-dimethylimidazo[1,2-a]pyridine |
| SMILES | Cc1cn2c(Br)ccc(C)c2n1 |
| InChI | InChI=1S/C9H9BrN2/c1-6-3-4-8(10)12-5-7(2)11-9(6)12/h3-5H,1-2H3 |
| InChIKey | PZECVWSYFOPGTF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.09 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|