About 5-fluoro-8-methoxy-2,6-dimethylimidazo[1,2-a]pyrazine
5-fluoro-8-methoxy-2,6-dimethylimidazo[1,2-a]pyrazine (PubChem CID 167501892) has the molecular formula C9H10FN3O
and a molecular weight of 195.20 g/mol. Its IUPAC name is 5-fluoro-8-methoxy-2,6-dimethylimidazo[1,2-a]pyrazine.
Analyze 5-fluoro-8-methoxy-2,6-dimethylimidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-8-methoxy-2,6-dimethylimidazo[1,2-a]pyrazine?
The IUPAC name of 5-fluoro-8-methoxy-2,6-dimethylimidazo[1,2-a]pyrazine (CID 167501892) is 5-fluoro-8-methoxy-2,6-dimethylimidazo[1,2-a]pyrazine.
What is the SMILES notation for 5-fluoro-8-methoxy-2,6-dimethylimidazo[1,2-a]pyrazine?
The canonical SMILES for 5-fluoro-8-methoxy-2,6-dimethylimidazo[1,2-a]pyrazine is COc1nc(C)c(F)n2cc(C)nc12.
What is the InChIKey of 5-fluoro-8-methoxy-2,6-dimethylimidazo[1,2-a]pyrazine?
The InChIKey is ANTOKLYCVUCSPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN3O/c1-5-4-13-7(10)6(2)12-9(14-3)8(13)11-5/h4H,1-3H3.
What are the key properties of 5-fluoro-8-methoxy-2,6-dimethylimidazo[1,2-a]pyrazine?
5-fluoro-8-methoxy-2,6-dimethylimidazo[1,2-a]pyrazine has a molecular weight of 195.20 g/mol, XLogP of 1.49, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-8-methoxy-2,6-dimethylimidazo[1,2-a]pyrazine is sourced from PubChem (CID 167501892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).