C18H16N2O2 — CID 59358197
5,7-dimethoxy-2-methylimidazo[1,2-f]phenanthridine (PubChem CID 59358197) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 5,7-dimethoxy-2-methylimidazo[1,2-f]phenanthridine.
| Compound Name | 5,7-dimethoxy-2-methylimidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 59358197 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 5,7-dimethoxy-2-methylimidazo[1,2-f]phenanthridine |
| SMILES | COc1cc(OC)c2c(c1)c1ccccc1c1nc(C)cn12 |
| InChI | InChI=1S/C18H16N2O2/c1-11-10-20-17-15(8-12(21-2)9-16(17)22-3)13-6-4-5-7-14(13)18(20)19-11/h4-10H,1-3H3 |
| InChIKey | HWGNZQUTDQYMTR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|